Products 2845-85-4
CAS 2845-85-4 appears in our catalog under these names: 4-chloroisophthalic acid, 98%, 4-Chloroisophthalic acid, 95%, 4-Chloroisophthalic Acid, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 10g, 250mg, 25g.
4-chlorobenzene-1,3-dicarboxylic acid (CAS 2845-85-4) is a chemical compound with the molecular formula C8H5ClO4 and a molecular weight of 200.57 g/mol. IUPAC name: 4-chlorobenzene-1,3-dicarboxylic acid. InChIKey: APLYBKHRTXFIBT-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO4 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 4-chlorobenzene-1,3-dicarboxylic acid |
| InChIKey | APLYBKHRTXFIBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)