Products 1967-31-3
CAS 1967-31-3 appears in our catalog under these names: 2-Chloroterephthalic acid, 95%, 2-Chloroterephthalic Acid, >98.0%(GC)(T), 2-Chloroterephthalic acid, 97%, 2-Chloroterephthalic acid 98%. Offered by: Combi-blocks, TCI, Thermo Scientific (Acros), Ambeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 200mg, 500mg.
2-chloroterephthalic acid (CAS 1967-31-3) is a chemical compound with the molecular formula C8H5ClO4 and a molecular weight of 200.57 g/mol. IUPAC name: 2-chloroterephthalic acid. InChIKey: ZPXGNBIFHQKREO-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO4 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 2-chloroterephthalic acid |
| InChIKey | ZPXGNBIFHQKREO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Chloroterephthalic acid, 2-chloro-1,4-benzenedicarboxylic acid, 2-chlorobenzene-1,4-dicarboxylic acid, 1,4-Benzenedicarboxylic acid, 2-chloro-, 2-Chloroterephthalicacid, 2-chloro terephthalic acid, 2-Chlorobenzene-1,4-dioic acid, Terephthalic acid, chloro-, chloroterephthalic acid, 2-C2-Chloroterephthalic Acid