CAS 2591-26-6 is the registry number for 6-Chloro-1,3-dioxaindane-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-1,3-benzodioxole-5-carboxylic acid (CAS 2591-26-6) is a chemical compound with the molecular formula C8H5ClO4 and a molecular weight of 200.57 g/mol. IUPAC name: 6-chloro-1,3-benzodioxole-5-carboxylic acid. InChIKey: NDFQRSMGWGHELT-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO4 |
|---|---|
| Molecular weight | 200.57 g/mol |
| IUPAC name | 6-chloro-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | NDFQRSMGWGHELT-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)