cas: 1233968-22-3 — see every product listed under this CAS number, including other names
2-Cyano-4-methoxyphenylboronic Acid 95% (CAS 1233968-22-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A845580-100mg |
| cas | 1233968-22-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 559.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A845580 |
(2-cyano-4-methoxyphenyl)boronic acid (CAS 1233968-22-3) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (2-cyano-4-methoxyphenyl)boronic acid. InChIKey: GZCUBWKIKPSBPB-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (2-cyano-4-methoxyphenyl)boronic acid |
| InChIKey | GZCUBWKIKPSBPB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)C#N)(O)O |
Computed by PubChem (NCBI)