cas: 612541-15-8 — see every product listed under this CAS number, including other names
2-Cyano-5-fluorobenzene-1-sulfonyl chloride, 98% (CAS 612541-15-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216785-100MG |
| cas | 612541-15-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 607.10 Pln | |
| Fluorochem | 1g | 1549.47 Pln | |
| Fluorochem | 5g | 4538.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-cyano-5-fluorobenzenesulfonyl chloride (CAS 612541-15-8) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 2-cyano-5-fluorobenzenesulfonyl chloride. InChIKey: WGFLZPKSPVMZOA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 2-cyano-5-fluorobenzenesulfonyl chloride |
| InChIKey | WGFLZPKSPVMZOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)