cas: 612541-15-8 — see every product listed under this CAS number, including other names
2-Cyano-5-fluorobenzenesulfonyl chloride, 98% (CAS 612541-15-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A101777-5g |
| cas | 612541-15-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7270.06 Pln | |
| AmBeed | 100mg | 603.82 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-cyano-5-fluorobenzenesulfonyl chloride (CAS 612541-15-8) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 2-cyano-5-fluorobenzenesulfonyl chloride. InChIKey: WGFLZPKSPVMZOA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 2-cyano-5-fluorobenzenesulfonyl chloride |
| InChIKey | WGFLZPKSPVMZOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)