cas: 1164100-85-9 — see every product listed under this CAS number, including other names
2-Cyano-6-methoxyphenylboronic Acid 98% (CAS 1164100-85-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A444493-100mg |
| cas | 1164100-85-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A444493 |
(2-cyano-6-methoxyphenyl)boronic acid (CAS 1164100-85-9) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (2-cyano-6-methoxyphenyl)boronic acid. InChIKey: PWYMDXIGOJTJPG-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (2-cyano-6-methoxyphenyl)boronic acid |
| InChIKey | PWYMDXIGOJTJPG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1OC)C#N)(O)O |
Computed by PubChem (NCBI)