2-Fluoro-3-nitrobenzoic Acid, 98%, 98%
cas: 317-46-4 — see every product listed under this CAS number, including other names
2-Fluoro-3-nitrobenzoic Acid, 98%, 98% (CAS 317-46-4) is a chemical reagent available from Chemat. Available pack sizes: 5kg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114H9X-5kg |
| cas | 317-46-4 |
| size | 5kg |
| availability | 25000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5kg | 4248.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 50g | 194.00 Pln | |
| Chemat | 100g | 285.20 Pln | |
| Chemat | 250g | 578.00 Pln | |
| Chemat | 500g | 883.20 Pln | |
| Chemat | 1kg | 1643.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-3-nitrobenzoic acid (CAS 317-46-4) is a chemical compound with the molecular formula C7H4FNO4 and a molecular weight of 185.11 g/mol. IUPAC name: 2-fluoro-3-nitrobenzoic acid. InChIKey: WLGUSLGYTNJJFV-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO4 |
|---|---|
| Molecular weight | 185.11 g/mol |
| IUPAC name | 2-fluoro-3-nitrobenzoic acid |
| InChIKey | WLGUSLGYTNJJFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])F)C(=O)O |
Computed by PubChem (NCBI)