Products 1000339-51-4
CAS 1000339-51-4 appears in our catalog under these names: 3–Fluoro–2–nitro–benzoic acid, 3-Fluoro-2-nitrobenzoic acid, 3-Fluoro-2-nitrobenzoic acid 98%, 3-Fluoro-2-nitrobenzoic acid, 98%, 98%, 3-Fluoro-2-nitrobenzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 50g, 100mg, 250mg, 1g.
3-fluoro-2-nitrobenzoic acid (CAS 1000339-51-4) is a chemical compound with the molecular formula C7H4FNO4 and a molecular weight of 185.11 g/mol. IUPAC name: 3-fluoro-2-nitrobenzoic acid. InChIKey: DTGONJAUUOWYGB-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO4 |
|---|---|
| Molecular weight | 185.11 g/mol |
| IUPAC name | 3-fluoro-2-nitrobenzoic acid |
| InChIKey | DTGONJAUUOWYGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)