cas: 1177009-38-9 — see every product listed under this CAS number, including other names
2-Fluoro-4-(trifluoromethyl)benzene-1-sulfonyl chloride, 98% (CAS 1177009-38-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A202014-10g |
| cas | 1177009-38-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 22946.14 Pln | |
| AmBeed | 5g | 13799.59 Pln | |
| AmBeed | 1g | 8533.00 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-fluoro-4-(trifluoromethyl)benzenesulfonyl chloride (CAS 1177009-38-9) is a chemical compound with the molecular formula C7H3ClF4O2S and a molecular weight of 262.61 g/mol. IUPAC name: 2-fluoro-4-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: FNYJQRYWXHLCSX-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O2S |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 2-fluoro-4-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | FNYJQRYWXHLCSX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)