Products 2773501-44-1

CAS 2773501-44-1 is the registry number for 2,3,4,5-Tetrafluoro-6-methylbenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,3,4,5-tetrafluoro-6-methylbenzenesulfonyl chloride (CAS 2773501-44-1) is a chemical compound with the molecular formula C7H3ClF4O2S and a molecular weight of 262.61 g/mol. IUPAC name: 2,3,4,5-tetrafluoro-6-methylbenzenesulfonyl chloride. InChIKey: XOLUPTCSFFGJOO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClF4O2S
Molecular weight262.61 g/mol
IUPAC name2,3,4,5-tetrafluoro-6-methylbenzenesulfonyl chloride
InChIKeyXOLUPTCSFFGJOO-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=C1S(=O)(=O)Cl)F)F)F)F

Computed by PubChem (NCBI)