CAS 2773501-44-1 is the registry number for 2,3,4,5-Tetrafluoro-6-methylbenzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,4,5-tetrafluoro-6-methylbenzenesulfonyl chloride (CAS 2773501-44-1) is a chemical compound with the molecular formula C7H3ClF4O2S and a molecular weight of 262.61 g/mol. IUPAC name: 2,3,4,5-tetrafluoro-6-methylbenzenesulfonyl chloride. InChIKey: XOLUPTCSFFGJOO-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O2S |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 2,3,4,5-tetrafluoro-6-methylbenzenesulfonyl chloride |
| InChIKey | XOLUPTCSFFGJOO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1S(=O)(=O)Cl)F)F)F)F |
Computed by PubChem (NCBI)