CAS 176225-09-5 appears in our catalog under these names: 4–Fluoro–2–(trifluoromethyl)benzenesulfonyl Chloride, 4-Fluoro-2-(trifluoromethyl)benzenesulfonyl chloride, 97+% , 4-Fluoro-2-(trifluoromethyl)benzenesulfonyl Chloride, >98.0%(GC), 4-Fluoro-2-(trifluoromethyl)benzene-1-sulfonyl chloride 95%, 4-Fluoro-2-(trifluoromethyl)benzenesulfonyl chloride, 95%. Offered by: GLPBio, Thermo Scientific, TCI, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 50g.
4-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride (CAS 176225-09-5) is a chemical compound with the molecular formula C7H3ClF4O2S and a molecular weight of 262.61 g/mol. IUPAC name: 4-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: IGMYEVQPXWKFQF-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O2S |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 4-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | IGMYEVQPXWKFQF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)