CAS 1177011-59-4 is the registry number for 2-Fluoro-3-(trifluoromethyl)benzene-1-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-fluoro-3-(trifluoromethyl)benzenesulfonyl chloride (CAS 1177011-59-4) is a chemical compound with the molecular formula C7H3ClF4O2S and a molecular weight of 262.61 g/mol. IUPAC name: 2-fluoro-3-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: XYFDWDIVRHEMRM-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O2S |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 2-fluoro-3-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | XYFDWDIVRHEMRM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)Cl)F)C(F)(F)F |
Computed by PubChem (NCBI)