CAS 1214372-88-9 appears in our catalog under these names: 3-Fluoro-2-(trifluoromethyl)benzene-1-sulfonyl chloride, 98%, 3-Fluoro-2-(trifluoromethyl)benzene-1-sulfonyl chloride, 3-Fluoro-2-(trifluoromethyl)benzenesulfonyl chloride, 95%, 95%, 3-FLUORO-2-(TRIFLUOROMETHYL)BENZENESULFONYL CHLORIDE, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 0,5g, 50mg, 100mg, 250mg.
3-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride (CAS 1214372-88-9) is a chemical compound with the molecular formula C7H3ClF4O2S and a molecular weight of 262.61 g/mol. IUPAC name: 3-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: IBPLJUDUCKFLHS-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O2S |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 3-fluoro-2-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | IBPLJUDUCKFLHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)Cl)C(F)(F)F)F |
Computed by PubChem (NCBI)