CAS 1375068-99-7 is the registry number for 2-Chloro-5-(trifluoromethyl)benzenesulfonyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-5-(trifluoromethyl)benzenesulfonyl fluoride (CAS 1375068-99-7) is a chemical compound with the molecular formula C7H3ClF4O2S and a molecular weight of 262.61 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)benzenesulfonyl fluoride. InChIKey: WTOANJPMZPJIIP-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4O2S |
|---|---|
| Molecular weight | 262.61 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)benzenesulfonyl fluoride |
| InChIKey | WTOANJPMZPJIIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)S(=O)(=O)F)Cl |
Computed by PubChem (NCBI)