2-Fluoro-4-biphenylylboronic acid, 98%
cas: 178305-99-2 — see every product listed under this CAS number, including other names
2-Fluoro-4-biphenylylboronic acid, 98% (CAS 178305-99-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A267411-1g |
| cas | 178305-99-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 214.62 Pln | |
| Ambeed | 25g | 542.81 Pln | |
| Ambeed | 100g | 1549.62 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 25g | 630.80 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 225.50 Pln | |
| BLDpharm | 25g | 525.40 Pln | |
| BLDpharm | 100g | 1669.44 Pln | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 305.12 Pln | |
| Fluorochem | 25g | 1164.19 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(3-fluoro-4-phenylphenyl)boronic acid (CAS 178305-99-2) is a chemical compound with the molecular formula C12H10BFO2 and a molecular weight of 216.02 g/mol. IUPAC name: (3-fluoro-4-phenylphenyl)boronic acid. InChIKey: BWYWXDFYJSIUBE-UHFFFAOYSA-N.
| Molecular formula | C12H10BFO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | (3-fluoro-4-phenylphenyl)boronic acid |
| InChIKey | BWYWXDFYJSIUBE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Fluoro-4-biphenylboronic Acid, 2-Fluoro-4-biphenylylboronic acid, 2-Fluorobiphenyl-4-boronic acid, (3-fluoro-4-phenylphenyl)boronic acid, 2-fluorobiphenyl-4-ylboronic acid, Boronic acid, B-(2-fluoro[1,1'-biphenyl]-4-yl)-, (2-fluoro-[1,1'-biphenyl]-4-yl)boronic acid, Boronic acid, (2-fluoro[1,1'-biphenyl]-4-yl)-, 3-Fluoro-4-phenylbenzeneboronic Acid, 2-Fluoro-biphenyl-4-boronic acid