2-Fluoro-4-nitrobenzoic acid, 99%+, 99%+
cas: 403-24-7 — see every product listed under this CAS number, including other names
2-Fluoro-4-nitrobenzoic acid, 99%+, 99%+ (CAS 403-24-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114H0P-250mg |
| cas | 403-24-7 |
| size | 250mg |
| availability | 2000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 50g | 174.80 Pln | |
| Chemat | 100g | 280.40 Pln | |
| Chemat | 250g | 597.20 Pln | |
| Chemat | 500g | 1166.40 Pln | |
| Chemat | 1kg | 1974.80 Pln |
properties
| purity | 99%+ |
|---|---|
| delivery time | 3 weeks |
2-fluoro-4-nitrobenzoic acid (CAS 403-24-7) is a chemical compound with the molecular formula C7H4FNO4 and a molecular weight of 185.11 g/mol. IUPAC name: 2-fluoro-4-nitrobenzoic acid. InChIKey: MMWFMFZFCKADEL-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO4 |
|---|---|
| Molecular weight | 185.11 g/mol |
| IUPAC name | 2-fluoro-4-nitrobenzoic acid |
| InChIKey | MMWFMFZFCKADEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])F)C(=O)O |
Computed by PubChem (NCBI)