2-Fluoro-5-nitrophenylboronic acid, 98%
cas: 819849-20-2 — see every product listed under this CAS number, including other names
2-Fluoro-5-nitrophenylboronic acid, 98% (CAS 819849-20-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 250mg, 100g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F016221-1G |
| cas | 819849-20-2 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 279.09 Pln | |
| Fluorochem | 25g | 560.24 Pln | |
| Fluorochem | 50g | 981.96 Pln | |
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 581.75 Pln | |
| Ambeed | 100g | 1939.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 179.60 Pln | |
| Chemat | 25g | 338.00 Pln | |
| Chemat | 50g | 611.60 Pln | |
| Chemat | 100g | 1014.80 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2-fluoro-5-nitrophenyl)boronic acid (CAS 819849-20-2) is a chemical compound with the molecular formula C6H5BFNO4 and a molecular weight of 184.92 g/mol. IUPAC name: (2-fluoro-5-nitrophenyl)boronic acid. InChIKey: SYAFEPQKPQIRAL-UHFFFAOYSA-N.
| Molecular formula | C6H5BFNO4 |
|---|---|
| Molecular weight | 184.92 g/mol |
| IUPAC name | (2-fluoro-5-nitrophenyl)boronic acid |
| InChIKey | SYAFEPQKPQIRAL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)[N+](=O)[O-])F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-fluoro-5-nitrophenyl)boronic acid, 2-Fluoro-5-nitrophenylboronic acid, 2-fluoro-5-nitrophenylboronicacid, (2-fluoro-5-nitro-phenyl)boronic Acid, Boronic acid, (2-fluoro-5-nitrophenyl)-, 2-fluoro-5-n, 2-fluoro-5-nitro phenyl boronic acid, 2-Fluoro-5-nitrophenylboronic acid(contains varying amounts of Anhydride)