cas: 883543-26-8 — see every product listed under this CAS number, including other names
2-Fluoro-5-trifluoromethylbenzyl chloride (CAS 883543-26-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021883-1G |
| cas | 883543-26-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 25g | 607.10 Pln |
| delivery time | 2-3 weeks |
|---|
2-(chloromethyl)-1-fluoro-4-(trifluoromethyl)benzene (CAS 883543-26-8) is a chemical compound with the molecular formula C8H5ClF4 and a molecular weight of 212.57 g/mol. IUPAC name: 2-(chloromethyl)-1-fluoro-4-(trifluoromethyl)benzene. InChIKey: OZGWDDBROIXNRQ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4 |
|---|---|
| Molecular weight | 212.57 g/mol |
| IUPAC name | 2-(chloromethyl)-1-fluoro-4-(trifluoromethyl)benzene |
| InChIKey | OZGWDDBROIXNRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CCl)F |
Computed by PubChem (NCBI)