2-Hydroxy-1-naphthoic acid
cas: 2283-08-1 — see every product listed under this CAS number, including other names
2-Hydroxy-1-naphthoic acid (CAS 2283-08-1) is a chemical reagent available from Chemat. Available pack sizes: 1x1000mg, 1g, 5g, 25g, 100g, 250g. Offered by: HPC Standards, Fluorochem.
| brand | HPC Standards |
|---|---|
| catalog number | 683360-1x1000mg |
| cas | 2283-08-1 |
| size | 1x1000mg |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| HPC Standards | 1x1000mg | price on request | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 25g | 216.61 Pln | |
| Fluorochem | 100g | 591.48 Pln | |
| Fluorochem | 250g | 1320.39 Pln |
properties
| delivery time | 2-3 weeks |
|---|
2-hydroxynaphthalene-1-carboxylic acid (CAS 2283-08-1) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 2-hydroxynaphthalene-1-carboxylic acid. InChIKey: UPHOPMSGKZNELG-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2-hydroxynaphthalene-1-carboxylic acid |
| InChIKey | UPHOPMSGKZNELG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Hydroxy-1-naphthoic acid, 1-Naphthalenecarboxylic acid, 2-hydroxy-, 1Naphthoic acid, 2hydroxy, 1Naphthoic acid, 2hydroxy (8CI), 1-Naphthoic acid, 2-hydroxy-(8CI), 1Naphthalenecarboxylic acid, 2hydroxy, UPHOPMSGKZNELG-UHFFFAOYSA-N, 2-hydroxynaphthalene-1-carboxylic acid, Hydroxynaphthoic acid, 2-hydroxynaphthalenecarboxylic acid