cas: 58089-25-1 — see every product listed under this CAS number, including other names
2-Mercapto-1H-benzimidazole-5-carboxylic acid, 97% (CAS 58089-25-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F066312-250MG |
| cas | 58089-25-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 482.14 Pln | |
| Fluorochem | 25g | 1070.47 Pln | |
| Fluorochem | 100g | 3751.82 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid (CAS 58089-25-1) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid. InChIKey: DCRZVUIGGYMOBI-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid |
| InChIKey | DCRZVUIGGYMOBI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=S)N2 |
Computed by PubChem (NCBI)