cas: 90416-52-7 — see every product listed under this CAS number, including other names
2-Methoxy-4,5-dimethylbenzene-1-sulfonyl chloride 98+% (CAS 90416-52-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A319983-250mg |
| cas | 90416-52-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 681.88 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A319983 |
2-methoxy-4,5-dimethylbenzenesulfonyl chloride (CAS 90416-52-7) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 2-methoxy-4,5-dimethylbenzenesulfonyl chloride. InChIKey: FQEJULWDCYVGCA-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 2-methoxy-4,5-dimethylbenzenesulfonyl chloride |
| InChIKey | FQEJULWDCYVGCA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)