cas: 1258196-40-5 — see every product listed under this CAS number, including other names
2-Methoxy-4-(9H-pyrido(3,4-b)indol-1-yl)phenol, 95-<97% (CAS 1258196-40-5) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC7068-95-97-2.5g |
| cas | 1258196-40-5 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 6668.86 Pln | |
| Hoffman Fine Chemicals | 5g | 10484.10 Pln | |
| Hoffman Fine Chemicals | 10g | 16589.76 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-methoxy-4-(9H-pyrido[3,4-b]indol-1-yl)phenol (CAS 1258196-40-5) is a chemical compound with the molecular formula C18H14N2O2 and a molecular weight of 290.3 g/mol. IUPAC name: 2-methoxy-4-(9H-pyrido[3,4-b]indol-1-yl)phenol. InChIKey: VIDRKSNPOZEXKW-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O2 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 2-methoxy-4-(9H-pyrido[3,4-b]indol-1-yl)phenol |
| InChIKey | VIDRKSNPOZEXKW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=NC=CC3=C2NC4=CC=CC=C34)O |
Computed by PubChem (NCBI)