CAS 56208-37-8 is the registry number for Disperse Yellow 39 surrogate. Offered by: Dr. Ehrenstorfer. Available pack sizes: 25mg.
3-(1-ethyl-2-hydroxyindol-3-yl)isoindol-1-one (CAS 56208-37-8) is a chemical compound with the molecular formula C18H14N2O2 and a molecular weight of 290.3 g/mol. IUPAC name: 3-(1-ethyl-2-hydroxyindol-3-yl)isoindol-1-one. InChIKey: KGZGXZIQLRICLZ-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O2 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 3-(1-ethyl-2-hydroxyindol-3-yl)isoindol-1-one |
| InChIKey | KGZGXZIQLRICLZ-UHFFFAOYSA-N |
| SMILES | CCN1C2=CC=CC=C2C(=C1O)C3=NC(=O)C4=CC=CC=C43 |
Computed by PubChem (NCBI)