CAS 2241495-55-4 is the registry number for 4-Methyl-3,5-di(pyridin-4-yl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-3,5-dipyridin-4-ylbenzoic acid (CAS 2241495-55-4) is a chemical compound with the molecular formula C18H14N2O2 and a molecular weight of 290.3 g/mol. IUPAC name: 4-methyl-3,5-dipyridin-4-ylbenzoic acid. InChIKey: LAHMMGXOEFSHGF-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O2 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 4-methyl-3,5-dipyridin-4-ylbenzoic acid |
| InChIKey | LAHMMGXOEFSHGF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1C2=CC=NC=C2)C(=O)O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)