Products 2241495-55-4

CAS 2241495-55-4 is the registry number for 4-Methyl-3,5-di(pyridin-4-yl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-methyl-3,5-dipyridin-4-ylbenzoic acid (CAS 2241495-55-4) is a chemical compound with the molecular formula C18H14N2O2 and a molecular weight of 290.3 g/mol. IUPAC name: 4-methyl-3,5-dipyridin-4-ylbenzoic acid. InChIKey: LAHMMGXOEFSHGF-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14N2O2
Molecular weight290.3 g/mol
IUPAC name4-methyl-3,5-dipyridin-4-ylbenzoic acid
InChIKeyLAHMMGXOEFSHGF-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1C2=CC=NC=C2)C(=O)O)C3=CC=NC=C3

Computed by PubChem (NCBI)