CAS 53013-38-0 appears in our catalog under these names: 2-Nitro-N,N-diphenylaniline, 97%, 2-Nitrophenyl Diphenylamine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
2-nitro-N,N-diphenylaniline (CAS 53013-38-0) is a chemical compound with the molecular formula C18H14N2O2 and a molecular weight of 290.3 g/mol. IUPAC name: 2-nitro-N,N-diphenylaniline. InChIKey: AEPMPJYRISCFKK-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O2 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 2-nitro-N,N-diphenylaniline |
| InChIKey | AEPMPJYRISCFKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)