CAS 3421-08-7 appears in our catalog under these names: 2,5-Bis(phenylamino)-2,5-cyclohexadiene-1,4-dione, DPPD–Q, 2,5-Bis(phenylamino)cyclohexa-2,5-diene-1,4-dione, 95%, 95%, DPPD-Q, 98.0%, DPPD-quinone. Offered by: TRC, GLPBio, Chemat, MedChemExpress, HPC Standards. Available pack sizes: 250mg, 500mg, 50mg, 10mg, 25mg, 100mg, 5 mg, 10 mg.
2,5-dianilinocyclohexa-2,5-diene-1,4-dione (CAS 3421-08-7) is a chemical compound with the molecular formula C18H14N2O2 and a molecular weight of 290.3 g/mol. IUPAC name: 2,5-dianilinocyclohexa-2,5-diene-1,4-dione. InChIKey: GETDOINCEIMJDH-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O2 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 2,5-dianilinocyclohexa-2,5-diene-1,4-dione |
| InChIKey | GETDOINCEIMJDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=O)C(=CC2=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)