cas: 385802-40-4 — see every product listed under this CAS number, including other names
2-Methoxy-5-(pyridin-4-yl)benzaldehyde, 98+% (CAS 385802-40-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A517690-5g |
| cas | 385802-40-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 23427.88 Pln | |
| AmBeed | 25g | 78098.86 Pln | |
| AmBeed | 10g | 39761.47 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-methoxy-5-pyridin-4-ylbenzaldehyde (CAS 385802-40-4) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 2-methoxy-5-pyridin-4-ylbenzaldehyde. InChIKey: OOTSXFWEFCBQQP-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 2-methoxy-5-pyridin-4-ylbenzaldehyde |
| InChIKey | OOTSXFWEFCBQQP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=NC=C2)C=O |
Computed by PubChem (NCBI)