CAS 206127-25-5 appears in our catalog under these names: methyl 6-phenylpyridine-2-carboxylate, 95%, Methyl 6–phenylpicolinate, Methyl 6-phenylpicolinate 95%, Methyl 6-phenylpicolinate, 95%, 95%, Methyl 6-phenylpicolinate, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Methyl 6-phenylpyridine-2-carboxylate (CAS 206127-25-5) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: methyl 6-phenylpyridine-2-carboxylate. InChIKey: SCLJKMDPGCDUNH-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | methyl 6-phenylpyridine-2-carboxylate |
| InChIKey | SCLJKMDPGCDUNH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)