2-Methyl-4-phenoxybenzoic acid, 97%
cas: 57830-13-4 — see every product listed under this CAS number, including other names
2-Methyl-4-phenoxybenzoic acid, 97% (CAS 57830-13-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A204977-250mg |
| cas | 57830-13-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 882.12 Pln | |
| Ambeed | 1g | 2283.88 Pln | |
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 914.00 Pln | |
| Chemat | 1g | 2618.00 Pln | |
| BLDpharm | 100mg | 453.20 Pln | |
| BLDpharm | 250mg | 941.92 Pln | |
| BLDpharm | 1g | 2452.49 Pln | |
| Fluorochem | 100mg | 789.32 Pln | |
| Fluorochem | 250mg | 1684.84 Pln | |
| Fluorochem | 1g | 4855.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-methyl-4-phenoxybenzoic acid (CAS 57830-13-4) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 2-methyl-4-phenoxybenzoic acid. InChIKey: CINTXXPQWRCNAU-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2-methyl-4-phenoxybenzoic acid |
| InChIKey | CINTXXPQWRCNAU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)