Products 57830-13-4
CAS 57830-13-4 appears in our catalog under these names: 2-Methyl-4-phenoxybenzoic acid, 2-Methyl-4-phenoxybenzoic acid, 95%, 2-Methyl-4-phenoxybenzoic acid 97%, 2-METHYL-4-PHENOXYBENZOIC ACID, 97%, 2-Methyl-4-phenoxybenzoic acid, 97%, 97%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 2,5g, 250mg, 1g, 5g, 100mg.
2-methyl-4-phenoxybenzoic acid (CAS 57830-13-4) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 2-methyl-4-phenoxybenzoic acid. InChIKey: CINTXXPQWRCNAU-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2-methyl-4-phenoxybenzoic acid |
| InChIKey | CINTXXPQWRCNAU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)