cas: 2941-66-4 — see every product listed under this CAS number, including other names
2-Methyl-5-nitrobenzo[d]thiazole, 97%, 97% (CAS 2941-66-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HNN-100mg |
| cas | 2941-66-4 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 736.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-methyl-5-nitro-1,3-benzothiazole (CAS 2941-66-4) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 2-methyl-5-nitro-1,3-benzothiazole. InChIKey: VEWGTWPJKSPGCD-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 2-methyl-5-nitro-1,3-benzothiazole |
| InChIKey | VEWGTWPJKSPGCD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)