cas: 24851-69-2 — see every product listed under this CAS number, including other names
2-Methylbenzo[d]thiazole-5-carboxylic acid 95% (CAS 24851-69-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A271483-100mg |
| cas | 24851-69-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 737.50 Pln | |
| Ambeed | 10g | 1371.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A271483 |
2-methyl-1,3-benzothiazole-5-carboxylic acid (CAS 24851-69-2) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 2-methyl-1,3-benzothiazole-5-carboxylic acid. InChIKey: TVUFPZOJUJGDDD-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 2-methyl-1,3-benzothiazole-5-carboxylic acid |
| InChIKey | TVUFPZOJUJGDDD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)