CAS 15120-47-5 appears in our catalog under these names: 2-Methylisophthalic acid, 98%, 2-Methylisophthalic acid, 95%, 95%, 2-METHYLISOPHTHALIC ACID, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
2-methylbenzene-1,3-dicarboxylic acid (CAS 15120-47-5) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2-methylbenzene-1,3-dicarboxylic acid. InChIKey: AIDLAEPHWROGFI-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-methylbenzene-1,3-dicarboxylic acid |
| InChIKey | AIDLAEPHWROGFI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)