cas: 16208-21-2 — see every product listed under this CAS number, including other names
2-Naphthylglyoxal hydrate, 97%(LC-MS),RG, 97%(LC-MS),RG (CAS 16208-21-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112SPH-250mg |
| cas | 16208-21-2 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 467.60 Pln | |
| Chemat | 5g | 1408.40 Pln |
| purity | 97%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
2-naphthalen-2-yl-2-oxoacetaldehyde;hydrate (CAS 16208-21-2) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 2-naphthalen-2-yl-2-oxoacetaldehyde;hydrate. InChIKey: VDEXQTPNFMMGEQ-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 2-naphthalen-2-yl-2-oxoacetaldehyde;hydrate |
| InChIKey | VDEXQTPNFMMGEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)C=O.O |
Computed by PubChem (NCBI)