CAS 883-99-8 appears in our catalog under these names: Methyl 3-hydroxy-2-naphthoate, 95%, Methyl 3–Hydroxy–2–naphthoate, Methyl 3-hydroxy-2-naphthoate, 98+% , Methyl 3-Hydroxy-2-naphthoate, >99.0%(GC), METHYL 3-HYDROXY-2-NAPHTHOATE, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich. Available pack sizes: 25g, 500g, 100g, 5g, 1g, 10g, 50g, 250g.
Methyl 3-hydroxynaphthalene-2-carboxylate (CAS 883-99-8) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 3-hydroxynaphthalene-2-carboxylate. InChIKey: YVVBECLPRBAATK-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 3-hydroxynaphthalene-2-carboxylate |
| InChIKey | YVVBECLPRBAATK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC=CC=C2C=C1O |
Computed by PubChem (NCBI)