CAS 147397-60-2 appears in our catalog under these names: 3-Methoxynaphthalene-1-carboxylic acid, 95%, 3–Methoxy–1–naphthoic acid, 3-Methoxynaphthalene-1-carboxylic acid, 3-Methoxy-1-naphthalenecarboxylic acid, 98%, 98%, 3-Methoxy-1-naphthoic acid, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 25mg, 2,5g, 5g.
3-methoxynaphthalene-1-carboxylic acid (CAS 147397-60-2) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 3-methoxynaphthalene-1-carboxylic acid. InChIKey: KDCWMJAKDVZCAO-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3-methoxynaphthalene-1-carboxylic acid |
| InChIKey | KDCWMJAKDVZCAO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC=CC=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)