CAS 52939-03-4 appears in our catalog under these names: 5-Phenylfuran-2-carboxylic acid methyl ester, 95%, METHYL 5–PHENYLFURAN–2–CARBOXYLATE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Methyl 5-phenylfuran-2-carboxylate (CAS 52939-03-4) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 5-phenylfuran-2-carboxylate. InChIKey: RQWRCTAAHRAAGB-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 5-phenylfuran-2-carboxylate |
| InChIKey | RQWRCTAAHRAAGB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)