CAS 883-62-5 appears in our catalog under these names: 3-Methoxy-2-naphthoic acid, 98%, 3–Methoxy–2–naphthoic Acid, 3-Methoxy-2-naphthoic Acid, >98.0%(GC)(T), 3-Methoxy-2-naphthoic acid, 98%, 98%, 3-methoxy-2-naphthoic acid, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 100mg, 250mg.
3-methoxynaphthalene-2-carboxylic acid (CAS 883-62-5) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 3-methoxynaphthalene-2-carboxylic acid. InChIKey: RTBQQRFTCVDODF-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3-methoxynaphthalene-2-carboxylic acid |
| InChIKey | RTBQQRFTCVDODF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC=CC=C2C=C1C(=O)O |
Computed by PubChem (NCBI)