Products 947-65-9
CAS 947-65-9 appears in our catalog under these names: Methyl 2-hydroxy-1-naphthoate, 95%, Methyl 2–hydroxy–1–naphthoate, Methyl 2-hydroxy-1-naphthoate 95%, Methyl 2-hydroxy-1-naphthoate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g, 100g, 100mg.
Methyl 2-hydroxynaphthalene-1-carboxylate (CAS 947-65-9) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 2-hydroxynaphthalene-1-carboxylate. InChIKey: LEENMPKUUNPLHM-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 2-hydroxynaphthalene-1-carboxylate |
| InChIKey | LEENMPKUUNPLHM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC2=CC=CC=C21)O |
Computed by PubChem (NCBI)
Synonyms:
Methyl 2-hydroxy-1-naphthoate, methyl 2-hydroxynaphthalene-1-carboxylate, Methyl-2-hydroxy-1-naphthalene carboxylate, 2-Hydroxy-1-naphthoic acid methyl ester, 2-Hydroxynaphthalene-1-carboxylic acid methyl ester, 1-Naphthalenecarboxylic acid, 2-hydroxy-, methyl ester, Oprea1_467520, 2-hydroxy-1-naphthalenecarboxylic acid methyl ester, Methyl 2-hydroxy-1-naphthoate #, 2-Hydroxy-1-naphthoate methyl ester