CAS 131526-88-0 is the registry number for 8-Hydroxy-2,3-dihydrocyclopenta[c]chromen-4(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
8-hydroxy-2,3-dihydro-1H-cyclopenta[c]chromen-4-one (CAS 131526-88-0) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 8-hydroxy-2,3-dihydro-1H-cyclopenta[c]chromen-4-one. InChIKey: LYCZVRBMNHDJRO-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 8-hydroxy-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
| InChIKey | LYCZVRBMNHDJRO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=O)OC3=C2C=C(C=C3)O |
Computed by PubChem (NCBI)