Products 13041-63-9
CAS 13041-63-9 appears in our catalog under these names: 4-Hydroxy-naphthalene-1-carboxylic acid methyl ester, 95%, Methyl 4–hydroxy–1–naphthoate, 1-Naphthalenecarboxylic acid, 4-hydroxy-, methyl ester, 95%, 95%, Methyl 4-hydroxy-1-naphthoate, 97%, Methyl 4-hydroxy-1-naphthoate, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g.
Methyl 4-hydroxynaphthalene-1-carboxylate (CAS 13041-63-9) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 4-hydroxynaphthalene-1-carboxylate. InChIKey: IVAXJJJTBDVHEA-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 4-hydroxynaphthalene-1-carboxylate |
| InChIKey | IVAXJJJTBDVHEA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C2=CC=CC=C21)O |
Computed by PubChem (NCBI)