cas: 90322-37-5 — see every product listed under this CAS number, including other names
2-Oxoindoline-4-carboxylic acid, 96%, 96% (CAS 90322-37-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117RUN-100mg |
| cas | 90322-37-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 1034.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-oxo-1,3-dihydroindole-4-carboxylic acid (CAS 90322-37-5) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 2-oxo-1,3-dihydroindole-4-carboxylic acid. InChIKey: ALXJUSWINGKGAW-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-oxo-1,3-dihydroindole-4-carboxylic acid |
| InChIKey | ALXJUSWINGKGAW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2NC1=O)C(=O)O |
Computed by PubChem (NCBI)