cas: 7113-10-2 — see every product listed under this CAS number, including other names
2-Phenylthiazole-4-carboxylic acid, 95%, 95% (CAS 7113-10-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HVX-250mg |
| cas | 7113-10-2 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 266.00 Pln | |
| Chemat | 10g | 323.60 Pln | |
| Chemat | 25g | 717.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-phenyl-1,3-thiazole-4-carboxylic acid (CAS 7113-10-2) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 2-phenyl-1,3-thiazole-4-carboxylic acid. InChIKey: IBUSLNJQKLZPNR-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 2-phenyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | IBUSLNJQKLZPNR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)