cas: 879-65-2 — see every product listed under this CAS number, including other names
2-Quinoxalinecarboxylic acid 97% (CAS 879-65-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A131240-1g |
| cas | 879-65-2 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 526.12 Pln | |
| Ambeed | 500g | 2322.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A131240 |
Quinoxaline-2-carboxylic acid (CAS 879-65-2) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: quinoxaline-2-carboxylic acid. InChIKey: UPUZGXILYFKSGE-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | quinoxaline-2-carboxylic acid |
| InChIKey | UPUZGXILYFKSGE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)