Products 879-65-2
CAS 879-65-2 appears in our catalog under these names: 2-Quinoxalinecarboxylic acid, 2–Quinoxalinecarboxylic acid, 2-Quinoxalinecarboxylic acid, 97%, 2-Quinoxalinecarboxylic acid 97%, 2-Quinoxalinecarboxylic acid, 99.20%. Offered by: Dr. Ehrenstorfer, GLPBio, Biosynth, HPC Standards, Thermo Scientific (Acros). Available pack sizes: 100mg, 100g, 25g, 50g, 250g, 500g, 1x100mg, 1g.
Quinoxaline-2-carboxylic acid (CAS 879-65-2) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: quinoxaline-2-carboxylic acid. InChIKey: UPUZGXILYFKSGE-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | quinoxaline-2-carboxylic acid |
| InChIKey | UPUZGXILYFKSGE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)