cas: 731742-58-8 — see every product listed under this CAS number, including other names
2-Thioxo-2,3-dihydro-1H-benzo[d]imidazole-4-carboxylic acid, 98%, 98% (CAS 731742-58-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116FV3-100mg |
| cas | 731742-58-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 520.40 Pln | |
| Chemat | 1g | 1317.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxylic acid (CAS 731742-58-8) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxylic acid. InChIKey: OMHCHRXJJPSEBZ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxylic acid |
| InChIKey | OMHCHRXJJPSEBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=S)N2)C(=O)O |
Computed by PubChem (NCBI)