cas: 14401-73-1 — see every product listed under this CAS number, including other names
3',5'-Dibromoacetophenone 97% (CAS 14401-73-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 10g, 25g, 100g, 5g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A249272-250mg |
| cas | 14401-73-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1154.69 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 500g | 5415.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A249272 |
1-(3,5-dibromophenyl)ethanone (CAS 14401-73-1) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 1-(3,5-dibromophenyl)ethanone. InChIKey: NHFJDRRYVMJBRJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 1-(3,5-dibromophenyl)ethanone |
| InChIKey | NHFJDRRYVMJBRJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)Br)Br |
Computed by PubChem (NCBI)