3'-Azido-3'-deoxythymidine, 99%, 99%
cas: 30516-87-1 — see every product listed under this CAS number, including other names
3'-Azido-3'-deoxythymidine, 99%, 99% (CAS 30516-87-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 25mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1141EV-1mg |
| cas | 30516-87-1 |
| size | 1mg |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 74.00 Pln | |
| Chemat | 25mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 155.60 Pln | |
| Chemat | 25g | 246.80 Pln | |
| Chemat | 100g | 818.00 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Zidovudine is a pyrimidine 2',3'-dideoxyribonucleoside compound having a 3'-azido substituent and thymine as the nucleobase. It has a role as an antimetabolite, an antiviral drug and a HIV-1 reverse transcriptase inhibitor. It is an azide and a pyrimidine 2',3'-dideoxyribonucleoside.
Source: ChEBI
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | HBOMLICNUCNMMY-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)N=[N+]=[N-] |
Computed by PubChem (NCBI)