cas: 30516-87-1 — see every product listed under this CAS number, including other names
1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione, 98% (CAS 30516-87-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 500mg, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F358376-100G |
| cas | 30516-87-1 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 1971.20 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 500mg | 102.07 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 25g | 534.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Zidovudine is a pyrimidine 2',3'-dideoxyribonucleoside compound having a 3'-azido substituent and thymine as the nucleobase. It has a role as an antimetabolite, an antiviral drug and a HIV-1 reverse transcriptase inhibitor. It is an azide and a pyrimidine 2',3'-dideoxyribonucleoside.
Source: ChEBI
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | HBOMLICNUCNMMY-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)N=[N+]=[N-] |
Computed by PubChem (NCBI)